953411-08-0 Usage
Description
5-METHYL-1H-INDOLE-2-BORONIC ACID is an organic compound that serves as a key intermediate in the synthesis of various pharmaceuticals and organic compounds. It is characterized by the presence of a boronic acid group attached to a 5-methyl-1H-indole moiety, which provides unique reactivity and properties for use in chemical reactions and applications.
Uses
Used in Pharmaceutical Industry:
5-METHYL-1H-INDOLE-2-BORONIC ACID is used as a key intermediate in the synthesis of quinazolinone derivatives, which are known for their potentiating effects on doxorubicin, a widely used chemotherapeutic drug. This application aids in enhancing the effectiveness of cancer treatments and improving patient outcomes.
Used in Organic Synthesis:
5-METHYL-1H-INDOLE-2-BORONIC ACID is utilized as a versatile building block in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique reactivity allows for the formation of new chemical entities with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 953411-08-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,3,4,1 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 953411-08:
(8*9)+(7*5)+(6*3)+(5*4)+(4*1)+(3*1)+(2*0)+(1*8)=160
160 % 10 = 0
So 953411-08-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BNO2/c1-6-2-3-8-7(4-6)5-9(11-8)10(12)13/h2-5,11-13H,1H3
