953411-10-4 Usage
Uses
Used in Pharmaceutical Drug Synthesis:
7-Bromo-1H-indazol-5-amine is used as a key intermediate in the synthesis of various pharmaceutical drugs. Its indazole motif contributes to the biological activity of the resulting compounds, enhancing their therapeutic potential.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 7-Bromo-1H-indazol-5-amine serves as a versatile building block for the development of new drug candidates. Its unique chemical properties allow for the creation of molecules with specific pharmacological profiles, targeting various diseases and conditions.
Used in Agrochemicals:
7-Bromo-1H-indazol-5-amine is also utilized in the agrochemical industry for the synthesis of compounds with pesticidal or herbicidal properties. Its reactivity and structural features enable the design of effective agrochemicals that can protect crops from pests and weeds.
Used in Chemical Research and Development:
7-Bromo-1H-indazol-5-amine plays a significant role in chemical research and development, where it is employed as a reagent in various organic synthesis processes. Its bromine atom allows for further functionalization and modification of the molecule, leading to the discovery of new compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 953411-10-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,3,4,1 and 1 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 953411-10:
(8*9)+(7*5)+(6*3)+(5*4)+(4*1)+(3*1)+(2*1)+(1*0)=154
154 % 10 = 4
So 953411-10-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrN3/c8-6-2-5(9)1-4-3-10-11-7(4)6/h1-3H,9H2,(H,10,11)
