953414-75-0 Usage
Uses
Used in Medicinal Chemistry and Drug Discovery:
1H-Pyrrolo[2,3-b]pyridine, 5-bromo-2-phenylis used as a building block for the synthesis of various organic compounds and pharmaceuticals. Its unique structure allows it to be an important intermediate in the field of organic synthesis, contributing to the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-2-phenylserves as a valuable intermediate. Its presence in the synthesis of complex organic molecules can lead to the creation of novel compounds with diverse applications.
Used in Chemical Research:
1H-Pyrrolo[2,3-b]pyridine, 5-bromo-2-phenylmay also serve as a valuable tool for studying the reactivity and behavior of heterocyclic compounds in chemical reactions. Understanding its properties can provide insights into the broader class of heterocyclic compounds and their potential applications in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 953414-75-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,3,4,1 and 4 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 953414-75:
(8*9)+(7*5)+(6*3)+(5*4)+(4*1)+(3*4)+(2*7)+(1*5)=180
180 % 10 = 0
So 953414-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H9BrN2/c14-11-6-10-7-12(16-13(10)15-8-11)9-4-2-1-3-5-9/h1-8H,(H,15,16)
