954239-25-9 Usage
Uses
Used in Pharmaceutical Research:
6-BENZYLOXY-1H-INDAZOLE-3-CARBOXYLIC ACID METHYL ESTER is used as a research compound for exploring its potential biological activities and pharmacological properties. The presence of the indazole core and the aromatic benzyl group may contribute to its efficacy in various therapeutic areas, making it a promising candidate for drug development.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 6-BENZYLOXY-1H-INDAZOLE-3-CARBOXYLIC ACID METHYL ESTER is used as a building block or a starting material for the synthesis of more complex molecules with potential therapeutic applications. Its unique structure allows for further functionalization and optimization to enhance its pharmacological profile.
Used in Drug Discovery:
6-BENZYLOXY-1H-INDAZOLE-3-CARBOXYLIC ACID METHYL ESTER is utilized in drug discovery processes to identify novel lead compounds with potential therapeutic effects. Its chemical properties and structural features make it a valuable tool for screening and optimization in the search for new drugs.
Used in Chemical Synthesis:
In the chemical synthesis industry, 6-BENZYLOXY-1H-INDAZOLE-3-CARBOXYLIC ACID METHYL ESTER serves as an intermediate or a precursor in the preparation of other organic compounds, particularly those with pharmaceutical or biological relevance. Its reactivity and functional groups enable its use in various synthetic routes and reactions.
Used in Biochemical Studies:
6-BENZYLOXY-1H-INDAZOLE-3-CARBOXYLIC ACID METHYL ESTER is employed in biochemical studies to investigate its interactions with biological targets, such as enzymes, receptors, or other macromolecules. Understanding these interactions can provide insights into its potential therapeutic mechanisms and help guide further optimization for specific applications.
Used in Analytical Chemistry:
In analytical chemistry, 6-BENZYLOXY-1H-INDAZOLE-3-CARBOXYLIC ACID METHYL ESTER may be used as a reference compound or a standard for the development and validation of analytical methods, such as high-performance liquid chromatography (HPLC), mass spectrometry, or nuclear magnetic resonance (NMR) spectroscopy. Its unique structure and properties make it suitable for these applications, ensuring accurate and reliable measurements in chemical analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 954239-25-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,4,2,3 and 9 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 954239-25:
(8*9)+(7*5)+(6*4)+(5*2)+(4*3)+(3*9)+(2*2)+(1*5)=189
189 % 10 = 9
So 954239-25-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H14N2O3/c1-20-16(19)15-13-8-7-12(9-14(13)17-18-15)21-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,17,18)
