954240-10-9 Usage
Uses
Used in Pharmaceutical Industry:
[3-(3-METHOXY-PHENYL)-ISOXAZOL-5-YL]-METHANOL is used as a chemical intermediate for the synthesis of pharmaceutical compounds, leveraging its unique structure to create novel drugs with potential therapeutic applications. Its ability to form stable bonds and its reactivity in chemical reactions make it a promising candidate for the development of new medications.
Used in Agrochemical Industry:
In the agrochemical sector, [3-(3-METHOXY-PHENYL)-ISOXAZOL-5-YL]-METHANOL is utilized as a building block in the creation of new agrochemicals, such as pesticides or herbicides. Its structural properties may contribute to the development of more effective and environmentally friendly products.
Used in Materials Science:
[3-(3-METHOXY-PHENYL)-ISOXAZOL-5-YL]-METHANOL is employed as a component in the synthesis of advanced materials, potentially contributing to the development of new polymers, coatings, or composites with improved properties. Its incorporation into these materials may enhance their performance, durability, or functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 954240-10-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,4,2,4 and 0 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 954240-10:
(8*9)+(7*5)+(6*4)+(5*2)+(4*4)+(3*0)+(2*1)+(1*0)=159
159 % 10 = 9
So 954240-10-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO3/c1-14-9-4-2-3-8(5-9)11-6-10(7-13)15-12-11/h2-6,13H,7H2,1H3
