95433-16-2 Usage
Uses
Used in Pharmaceutical Industry:
3-(2-Phenoxyphenyl)acrylic acid is used as a key intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and properties allow it to be incorporated into the development of new drugs, potentially leading to innovative treatments and therapies.
Used in Agricultural Industry:
In the agricultural sector, 3-(2-Phenoxyphenyl)acrylic acid is utilized in the production of agricultural compounds. Its chemical properties make it suitable for the development of new pesticides, herbicides, and other agrochemicals, contributing to more effective and sustainable agricultural practices.
Used in Dye and Pigment Industry:
3-(2-Phenoxyphenyl)acrylic acid is used as a key intermediate in the synthesis of dyes and pigments. Its ability to form various chemical bonds and structures enables the creation of a wide range of colorants for use in textiles, plastics, inks, and other applications, enhancing the vibrancy and stability of colors in various industries.
Used in Specialty Chemicals Production:
As a versatile chemical intermediate, 3-(2-Phenoxyphenyl)acrylic acid is employed in the production of specialty chemicals. Its unique properties allow it to be incorporated into the development of high-performance materials, such as polymers, coatings, and adhesives, with specific characteristics tailored to various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 95433-16-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,4,3 and 3 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 95433-16:
(7*9)+(6*5)+(5*4)+(4*3)+(3*3)+(2*1)+(1*6)=142
142 % 10 = 2
So 95433-16-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H12O3/c16-15(17)11-10-12-6-4-5-9-14(12)18-13-7-2-1-3-8-13/h1-11H,(H,16,17)/b11-10+
95433-16-2Relevant academic research and scientific papers
Structural isomers of cinnamic hydroxamic acids block HCV replication via different mechanisms
Kozlov, Maxim V.,Konduktorov, Konstantin A.,Malikova, Alsu Z.,Kamarova, Kamila A.,Shcherbakova, Anastasia S.,Solyev, Pavel N.,Kochetkov, Sergey N.
, (2019/09/30)
A set of ortho-, meta- and para-substituted cinnamic hydroxamic acids (CHAs) was synthesized. In each series of structural isomers, a phenyl substituent was linked to an aromatic ring of the parent cinnamic acid via a linker of one to four atoms in length
