95470-68-1 Usage
Uses
Used in Pharmaceutical Industry:
(4-Isopropyl-piperazin-1-yl)-acetic acid is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and potential interactions may contribute to the development of new drugs with specific therapeutic applications.
Used in Chemical Research:
In the field of chemical research, (4-Isopropyl-piperazin-1-yl)-acetic acid serves as a valuable compound for studying the properties and reactivity of piperazine derivatives. This can lead to a better understanding of the structure-activity relationships and potential applications in various chemical processes.
Used in Material Science:
(4-Isopropyl-piperazin-1-yl)-acetic acid may be utilized in the development of new materials with specific properties, such as improved stability or reactivity. Its incorporation into polymers or other materials could result in novel applications in various industries, including electronics, coatings, or adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 95470-68-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,4,7 and 0 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 95470-68:
(7*9)+(6*5)+(5*4)+(4*7)+(3*0)+(2*6)+(1*8)=161
161 % 10 = 1
So 95470-68-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H18N2O2/c1-8(2)11-5-3-10(4-6-11)7-9(12)13/h8H,3-7H2,1-2H3,(H,12,13)
95470-68-1Relevant academic research and scientific papers
BENZOFURAN DERIVATIVE
-
Page 190, (2008/06/13)
The present invention provides a benzofuran derivative of the formula [1]: wherein x is a group of the formula: -N="or" -CH=; Y is an optionally substituted amino group, an optionally substituted cycloalkyl group or an optionally substituted saturated heterocyclic group; A is a single bond, a carbon chain optionally having a double bond within or at the end(s) of the chain, or an oxygen atom; R1 is a hydrogen atom or a halogen atom; Ring B is an optionally substituted benzene ring; and R3 is a hydrogen atom, or a pharmaceutically acceptable salt thereof, which is useful as a medicament, especially as an activated blood coagulation factor X inhibitor.
