95480-29-8 Usage
Uses
Used in Organic Synthesis:
1-(4-Ethoxyphenyl)-2-(4-n-pentylphenyl)-acetylene is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for the formation of new chemical bonds and the creation of complex molecules, making it valuable in the development of pharmaceuticals, agrochemicals, and other fine chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-(4-Ethoxyphenyl)-2-(4-n-pentylphenyl)-acetylene is used as a building block for the synthesis of new drug candidates. Its potential biological and pharmacological activities, such as anti-inflammatory and analgesic properties, make it a promising candidate for the development of novel therapeutic agents.
Used in Agrochemical Industry:
1-(4-Ethoxyphenyl)-2-(4-n-pentylphenyl)-acetylene is also utilized in the agrochemical industry for the synthesis of new pesticides and other agricultural chemicals. Its unique structure and reactivity can contribute to the development of more effective and environmentally friendly products.
Safety Precautions:
As with all chemicals, proper handling and safety precautions should be followed when working with 1-(4-Ethoxyphenyl)-2-(4-n-pentylphenyl)-acetylene. This includes wearing appropriate personal protective equipment, working in a well-ventilated area, and following established safety protocols to minimize risks associated with chemical exposure.
Check Digit Verification of cas no
The CAS Registry Mumber 95480-29-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,4,8 and 0 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 95480-29:
(7*9)+(6*5)+(5*4)+(4*8)+(3*0)+(2*2)+(1*9)=158
158 % 10 = 8
So 95480-29-8 is a valid CAS Registry Number.
InChI:InChI=1/C21H24O/c1-3-5-6-7-18-8-10-19(11-9-18)12-13-20-14-16-21(17-15-20)22-4-2/h8-11,14-17H,3-7H2,1-2H3
