955-36-2 Usage
Uses
Used in Pharmaceutical Industry:
4-Butoxy-3-chloro-5-methoxybenzoic acid is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs. Its unique structure allows for the creation of complex molecules with potential therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 4-Butoxy-3-chloro-5-methoxybenzoic acid serves as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its chemical properties make it a valuable component in the formulation of effective agricultural products.
Used in Organic Chemistry:
4-Butoxy-3-chloro-5-methoxybenzoic acid is utilized as a building block in organic chemistry for the synthesis of more complex molecules. Its versatile structure allows for further chemical reactions and modifications, leading to the development of novel compounds with various applications.
Used in Antibacterial Applications:
4-Butoxy-3-chloro-5-methoxybenzoic acid has been studied for its potential antibacterial properties, making it a candidate for use in applications requiring bacterial control, such as in medical or industrial settings.
Used in Antifungal Applications:
4-BUTOXY-3-CHLORO-5-METHOXYBENZOIC ACID has also been investigated for its antifungal properties, suggesting its potential use in applications where control of fungal growth is necessary, such as in agriculture or in the treatment of fungal infections.
Check Digit Verification of cas no
The CAS Registry Mumber 955-36-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,5 and 5 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 955-36:
(5*9)+(4*5)+(3*5)+(2*3)+(1*6)=92
92 % 10 = 2
So 955-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H15ClO4/c1-3-4-5-17-11-9(13)6-8(12(14)15)7-10(11)16-2/h6-7H,3-5H2,1-2H3,(H,14,15)/p-1
