95574-95-1 Usage
General Description
2,7-anhydro-N-acetylneuraminic acid is a chemical compound that is derived from the sugar molecule sialic acid. It is involved in various biological processes such as cell adhesion, migration, and signaling. 2,7-anhydro-N-acetylneuraminic acid has been found to be particularly important in the immune system, where it plays a role in modulating the immune response and in the recognition and destruction of pathogens. Additionally, 2,7-anhydro-N-acetylneuraminic acid has potential applications in the development of pharmaceuticals and biotechnology, as its unique properties make it a valuable tool in the study and manipulation of biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 95574-95-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,5,7 and 4 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 95574-95:
(7*9)+(6*5)+(5*5)+(4*7)+(3*4)+(2*9)+(1*5)=181
181 % 10 = 1
So 95574-95-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO8/c1-4(14)12-7-5(15)2-11(10(17)18)19-8(6(16)3-13)9(7)20-11/h5-9,13,15-16H,2-3H2,1H3,(H,12,14)(H,17,18)/t5-,6+,7+,8+,9+,11+/m0/s1
