956003-87-5 Usage
Uses
Used in Pharmaceutical Industry:
(3,5-Difluoropyridin-4-yl)boronic acid is used as a key intermediate in the synthesis of pharmaceuticals. Its ability to form stable boronate esters with organic molecules makes it a valuable component in the development of new drugs with improved properties, such as enhanced solubility, stability, and bioavailability.
Used in Agrochemical Industry:
In the agrochemical industry, (3,5-Difluoropyridin-4-yl)boronic acid is utilized as a building block for the synthesis of agrochemicals, including pesticides and herbicides. The formation of boronate esters with reactive functional groups in these molecules can lead to the development of more effective and environmentally friendly agrochemicals.
Used in Organic Synthesis:
(3,5-Difluoropyridin-4-yl)boronic acid is employed as a versatile reagent in organic synthesis. Its reactivity with a wide range of organic molecules allows for the formation of complex organic structures, facilitating the synthesis of novel compounds with potential applications in various fields, such as materials science, catalysis, and biochemistry.
Used in Research and Development:
In research and development, (3,5-Difluoropyridin-4-yl)boronic acid serves as a valuable tool for exploring new chemical reactions and mechanisms. Its unique properties and reactivity with various organic molecules enable chemists to investigate new synthetic routes and develop innovative strategies for the synthesis of complex organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 956003-87-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,6,0,0 and 3 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 956003-87:
(8*9)+(7*5)+(6*6)+(5*0)+(4*0)+(3*3)+(2*8)+(1*7)=175
175 % 10 = 5
So 956003-87-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H4BF2NO2/c7-3-1-9-2-4(8)5(3)6(10)11/h1-2,10-11H
