957035-06-2 Usage
Uses
Used in Organic Synthesis:
8-Fluoro-2-methylquinolin-7-ylboronic acid is used as a synthetic intermediate for the preparation of various organic compounds. Its unique structure allows it to participate in a range of reactions, such as Suzuki-Miyaura cross-coupling, which is a widely used method for the formation of carbon-carbon bonds.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 8-Fluoro-2-methylquinolin-7-ylboronic acid is used as a building block for the development of new drugs. Its ability to form stable complexes with biological targets makes it a promising candidate for the design of novel therapeutic agents, particularly those targeting enzyme active sites or receptor binding pockets.
Used in Drug Discovery:
8-Fluoro-2-methylquinolin-7-ylboronic acid is utilized in high-throughput screening assays to identify potential lead compounds for drug development. Its unique chemical properties may allow it to modulate biological pathways or inhibit specific enzymes, providing a starting point for the optimization of drug candidates.
Used in Chemical Research:
8-Fluoro-2-methylquinolin-7-ylboronic acid serves as a subject of study in chemical research to explore its reactivity, stability, and potential applications. Understanding its properties can lead to the discovery of new synthetic methods or the development of novel materials with specific functions.
Check Digit Verification of cas no
The CAS Registry Mumber 957035-06-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,7,0,3 and 5 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 957035-06:
(8*9)+(7*5)+(6*7)+(5*0)+(4*3)+(3*5)+(2*0)+(1*6)=182
182 % 10 = 2
So 957035-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BFNO2/c1-6-2-3-7-4-5-8(11(14)15)9(12)10(7)13-6/h2-5,14-15H,1H3
