957060-88-7 Usage
Uses
Used in Organic Chemistry:
3-Chloro-2-methoxypyridin-4-ylboronic acid is used as a reagent in organic chemistry for the synthesis of complex organic molecules. Its boronic acid structure allows it to participate in various chemical reactions, such as the Suzuki-Miyaura cross-coupling reaction, which is a widely used method for the formation of carbon-carbon bonds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-Chloro-2-methoxypyridin-4-ylboronic acid is used as a building block for the development of new drugs. Its ability to form stable complexes with biologically relevant molecules makes it a promising candidate for the design of novel therapeutic agents, particularly in the areas of medicinal chemistry and drug discovery.
Safety Information:
It is essential to handle 3-Chloro-2-methoxypyridin-4-ylboronic acid with care, as it may have specific safety requirements. Detailed safety information, including proper handling, storage, and disposal procedures, can be found on its material safety data sheet. This ensures that users can work with the compound safely and effectively in both scientific and industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 957060-88-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,7,0,6 and 0 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 957060-88:
(8*9)+(7*5)+(6*7)+(5*0)+(4*6)+(3*0)+(2*8)+(1*8)=197
197 % 10 = 7
So 957060-88-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BClNO3/c1-12-6-5(8)4(7(10)11)2-3-9-6/h2-3,10-11H,1H3
