957062-96-3 Usage
Uses
Used in Pharmaceutical Industry:
5-Fluoro-2-(methylcarbamoyl)phenylboronic acid is utilized as a key intermediate in the synthesis of various pharmaceutical drugs. Its unique structure allows for the development of new drug candidates with potential therapeutic applications, such as antibacterial, antiviral, and anticancer agents. The presence of the boronic acid group facilitates the formation of carbon-carbon bonds, enabling the construction of complex molecular frameworks that are otherwise challenging to achieve.
Used in Organic Synthesis:
In the field of organic synthesis, 5-Fluoro-2-(methylcarbamoyl)phenylboronic acid is employed as a versatile reagent for the creation of a wide range of organic compounds. Its reactivity in Suzuki-Miyaura cross-coupling reactions makes it an indispensable tool for chemists, allowing for the efficient formation of carbon-carbon bonds and the synthesis of complex organic molecules with diverse applications, such as agrochemicals, dyes, and advanced materials.
Used in Medicinal Chemistry Research:
5-Fluoro-2-(methylcarbamoyl)phenylboronic acid is used as a valuable research tool in medicinal chemistry. Its unique structural features and reactivity make it an attractive candidate for the development of novel bioactive compounds with potential therapeutic applications. Researchers can leverage the compound's properties to explore new chemical space and design innovative drug candidates with improved pharmacological profiles.
Used in Chemical Research and Development:
In the realm of chemical research and development, 5-Fluoro-2-(methylcarbamoyl)phenylboronic acid is employed as a crucial reagent for the synthesis and modification of various chemical compounds. Its versatility and reactivity in cross-coupling reactions contribute to the advancement of chemical science, enabling the discovery of new chemical entities with potential applications in various industries, such as pharmaceuticals, materials science, and agrochemicals.
Overall, 5-fluoro-2-(methylcarbamoyl)phenylboronic acid is a highly valuable chemical compound with diverse applications across multiple industries, particularly in pharmaceuticals, organic synthesis, and chemical research and development. Its unique structure and reactivity make it an indispensable tool for the creation of new and innovative compounds with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 957062-96-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,7,0,6 and 2 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 957062-96:
(8*9)+(7*5)+(6*7)+(5*0)+(4*6)+(3*2)+(2*9)+(1*6)=203
203 % 10 = 3
So 957062-96-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BFNO3/c1-11-8(12)6-3-2-5(10)4-7(6)9(13)14/h2-4,13-14H,1H3,(H,11,12)
