957065-93-9 Usage
Uses
Used in Pharmaceutical Industry:
2-(3-Bromophenyl)-5-(thien-2-yl)-1,3,4-oxadiazole is used as an intermediate in the synthesis of pharmaceuticals for its potential biological activities. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
2-(3-Bromophenyl)-5-(thien-2-yl)-1,3,4-oxadiazole is used as an intermediate in the synthesis of agrochemicals, contributing to the development of new pesticides or other agricultural chemicals with improved efficacy and selectivity.
Used in Organic Chemistry Research:
2-(3-Bromophenyl)-5-(thien-2-yl)-1,3,4-oxadiazole is used as a research compound in organic chemistry to explore its unique structure and properties. This can lead to the discovery of new reactions or applications in various chemical processes.
Used in Material Science:
2-(3-Bromophenyl)-5-(thien-2-yl)-1,3,4-oxadiazole is used in material science for its potential applications in the development of new materials with specific properties. Its unique structure and properties can contribute to the creation of advanced materials for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 957065-93-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,7,0,6 and 5 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 957065-93:
(8*9)+(7*5)+(6*7)+(5*0)+(4*6)+(3*5)+(2*9)+(1*3)=209
209 % 10 = 9
So 957065-93-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H7BrN2OS/c13-9-4-1-3-8(7-9)11-14-15-12(16-11)10-5-2-6-17-10/h1-7H
