957066-05-6 Usage
Uses
Used in Pharmaceutical Industry:
(3'-Bromo-4'-morpholino)acetophenone is used as a key intermediate in the synthesis of various pharmaceuticals due to its ability to facilitate the formation of diverse chemical structures. The presence of the bromine atom and morpholine group enhances its reactivity, making it a valuable component in the development of new drugs and medicinal agents.
Used in Organic Synthesis:
In the field of organic synthesis, (3'-Bromo-4'-morpholino)acetophenone is employed as a reagent to create a wide range of organic compounds. Its acetophenone group provides a reactive center that allows for various synthetic reactions, contributing to the compound's utility in constructing complex organic molecules.
Used in Research and Development Laboratories:
(3'-Bromo-4'-morpholino)acetophenone is utilized as a research reagent in laboratories focused on organic synthesis. Its unique structural features make it an essential tool for scientists to explore new synthetic pathways and develop innovative chemical processes.
Overall, (3'-Bromo-4'-morpholino)acetophenone's applications span across the chemical, pharmaceutical, and research industries, highlighting its significance in the development of new compounds and the advancement of scientific knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 957066-05-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,7,0,6 and 6 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 957066-05:
(8*9)+(7*5)+(6*7)+(5*0)+(4*6)+(3*6)+(2*0)+(1*5)=196
196 % 10 = 6
So 957066-05-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H14BrNO2/c1-9(15)10-2-3-12(11(13)8-10)14-4-6-16-7-5-14/h2-3,8H,4-7H2,1H3
