957066-09-0 Usage
Uses
Used in Organic Synthesis:
5-Borono-4-chloro-2-methoxybenzoic acid is utilized as a key building block in organic synthesis for the creation of pharmaceuticals and agrochemicals. Its boronic acid group provides unique reactivity, facilitating the formation of carbon-carbon bonds, which is crucial for the synthesis of complex organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-Borono-4-chloro-2-methoxybenzoic acid serves as an important intermediate for the development of new drugs. Its structural features, including the chloro and methoxy groups, can be tailored to enhance the compound's biological activity and selectivity towards specific targets, thereby contributing to the discovery of novel therapeutic agents.
Used in Chemical Research:
5-Borono-4-chloro-2-methoxybenzoic acid is also employed in chemical research to explore new reaction pathways and mechanisms. Its unique reactivity and structural attributes make it an attractive candidate for studying the fundamental aspects of chemical bonding and reaction dynamics.
Used in the Agrochemical Industry:
5-Borono-4-chloro-2-methoxybenzoic acid is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its potential to be modified and functionalized allows for the development of compounds with improved efficacy and selectivity in agricultural applications.
Used in the Development of Advanced Materials:
5-Borono-4-chloro-2-methoxybenzoic acid's unique structure and properties also make it a candidate for the development of advanced materials with specific applications in various industries, such as electronics, coatings, and polymers. Its potential to form stable and functional materials can contribute to the advancement of technology and innovation in material science.
Check Digit Verification of cas no
The CAS Registry Mumber 957066-09-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,7,0,6 and 6 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 957066-09:
(8*9)+(7*5)+(6*7)+(5*0)+(4*6)+(3*6)+(2*0)+(1*9)=200
200 % 10 = 0
So 957066-09-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BClO5/c1-15-7-3-6(10)5(9(13)14)2-4(7)8(11)12/h2-3,13-14H,1H3,(H,11,12)
