957066-11-4 Usage
General Description
6-Chloro-1-methyl-1H-indol-2-ylboronic acid is a chemical compound with the molecular formula C9H9BClNO2. It is commonly used in organic synthesis and medicinal chemistry as a building block to create more complex compounds. This chemical is characterized by the presence of a boronic acid group, which makes it a valuable tool for the formation of carbon-carbon bonds through Suzuki-Miyaura coupling reactions. Its unique structure also makes it a versatile intermediate for the synthesis of pharmaceuticals and agrochemicals. Additionally, its indole moiety gives it potential biological activity, making it a subject of interest for drug discovery and development. Overall, 6-Chloro-1-methyl-1H-indol-2-ylboronic acid is a valuable and versatile chemical tool with a wide range of applications in the fields of organic chemistry and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 957066-11-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,7,0,6 and 6 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 957066-11:
(8*9)+(7*5)+(6*7)+(5*0)+(4*6)+(3*6)+(2*1)+(1*1)=194
194 % 10 = 4
So 957066-11-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H9BClNO2/c1-12-8-5-7(11)3-2-6(8)4-9(12)10(13)14/h2-5,13-14H,1H3
