957066-11-4 Usage
Uses
Used in Organic Synthesis:
6-Chloro-1-methyl-1H-indol-2-ylboronic acid is used as a building block in organic synthesis for the creation of more complex compounds. Its boronic acid group facilitates the formation of carbon-carbon bonds through Suzuki-Miyaura coupling reactions, making it a valuable tool in the synthesis of various organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 6-Chloro-1-methyl-1H-indol-2-ylboronic acid is used as a versatile intermediate for the synthesis of pharmaceuticals. Its unique structure allows for the development of new drug candidates with potential therapeutic applications.
Used in Drug Discovery and Development:
The indole moiety present in 6-Chloro-1-methyl-1H-indol-2-ylboronic acid gives it potential biological activity, making it a subject of interest for drug discovery and development. Researchers can explore its properties and interactions with biological targets to identify new therapeutic agents.
Used in Agrochemical Synthesis:
6-Chloro-1-methyl-1H-indol-2-ylboronic acid is also used in the synthesis of agrochemicals, where its unique structure and reactivity can contribute to the development of new pesticides, herbicides, or other agricultural chemicals.
Overall, 6-Chloro-1-methyl-1H-indol-2-ylboronic acid is a valuable and versatile chemical tool with a wide range of applications in the fields of organic chemistry, medicinal research, drug discovery, and agrochemical development.
Check Digit Verification of cas no
The CAS Registry Mumber 957066-11-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,7,0,6 and 6 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 957066-11:
(8*9)+(7*5)+(6*7)+(5*0)+(4*6)+(3*6)+(2*1)+(1*1)=194
194 % 10 = 4
So 957066-11-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H9BClNO2/c1-12-8-5-7(11)3-2-6(8)4-9(12)10(13)14/h2-5,13-14H,1H3
