95742-19-1 Usage
Uses
Used in Pharmaceutical Industry:
6-Fluoro-3-(4-piperidine)-1,2-benzoisoxazole hydrochloride is used as a synthetic intermediate for the development of new pharmaceutical compounds. Its unique structure allows for the creation of novel drug candidates with potential therapeutic applications, such as in the treatment of various diseases and disorders.
Used in Agrochemical Industry:
In the agrochemical industry, 6-Fluoro-3-(4-piperidine)-1,2-benzoisoxazole hydrochloride is utilized as a synthetic intermediate for the production of innovative agrochemicals. Its incorporation into these products can lead to the development of new pesticides, herbicides, or other agricultural chemicals that can improve crop yields and protect plants from pests and diseases.
Overall, 6-Fluoro-3-(4-piperidine)-1,2-benzoisoxazole hydrochloride is a valuable chemical intermediate with a wide range of applications in both the pharmaceutical and agrochemical industries, contributing to the development of new and improved products for various purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 95742-19-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,7,4 and 2 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 95742-19:
(7*9)+(6*5)+(5*7)+(4*4)+(3*2)+(2*1)+(1*9)=161
161 % 10 = 1
So 95742-19-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H13FN2O.ClH/c13-9-1-2-10-11(7-9)16-15-12(10)8-3-5-14-6-4-8;/h1-2,7-8,14H,3-6H2;1H
