959238-22-3 Usage
Uses
Used in Pharmaceutical Industry:
[4-(AMINOMETHYL)TETRAHYDRO-2H-PYRAN-4-YL]METHANOL is used as a chemical intermediate for the development of pharmaceutical compounds due to its unique structure and functional groups that can be further modified or incorporated into more complex molecules for therapeutic purposes.
Used in Organic Synthesis:
In the field of organic synthesis, [4-(AMINOMETHYL)TETRAHYDRO-2H-PYRAN-4-YL]METHANOL serves as a building block for the creation of more complex organic molecules. Its presence of both amino and hydroxyl functional groups allows for versatile chemical reactions, facilitating the synthesis of a wide range of organic compounds.
Used in Research:
[4-(AMINOMETHYL)TETRAHYDRO-2H-PYRAN-4-YL]METHANOL is utilized as a research compound to study its chemical properties, reactivity, and potential interactions with other molecules. This can lead to a better understanding of its behavior in various chemical environments and its applicability in different fields of chemistry and biology.
Check Digit Verification of cas no
The CAS Registry Mumber 959238-22-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,9,2,3 and 8 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 959238-22:
(8*9)+(7*5)+(6*9)+(5*2)+(4*3)+(3*8)+(2*2)+(1*2)=213
213 % 10 = 3
So 959238-22-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H15NO2/c8-5-7(6-9)1-3-10-4-2-7/h9H,1-6,8H2
959238-22-3Relevant academic research and scientific papers
HETEROCYCLIC COMPOUNDS CONTAINING AN INDOLE CORE
-
Page/Page column 82, (2011/06/26)
Disclosed are novel compounds which inhibit RSK, methods of making such compounds and pharmaceutical compositions comprising such compounds. Also disclosed are methods of treating RSK2 regulated disorders using compounds of the invention.
