959244-16-7 Usage
Uses
Used in Pharmaceutical Industry:
4-Chloro-6-hydroxypyridine-2-carboxylic acid is used as an intermediate in the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Agrochemical Industry:
In the agrochemical industry, 4-Chloro-6-hydroxypyridine-2-carboxylic acid serves as a building block for the creation of new agrochemicals. Its properties make it suitable for the development of pesticides, herbicides, and other agricultural chemicals that can improve crop yield and protect plants from pests and diseases.
Used in Fluorescent Dye Production:
4-Chloro-6-hydroxypyridine-2-carboxylic acid is used as a precursor in the production of fluorescent dyes. Its chemical structure contributes to the development of dyes with specific fluorescence properties, which can be utilized in various applications such as bioimaging, diagnostics, and sensing.
Used in Specialty Chemicals Production:
4-Chloro-6-hydroxypyridine-2-carboxylic acid is also used in the production of specialty chemicals, which are tailored for specific applications in various industries. Its unique properties make it a valuable component in the development of high-performance materials, coatings, and other specialized products.
Check Digit Verification of cas no
The CAS Registry Mumber 959244-16-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,9,2,4 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 959244-16:
(8*9)+(7*5)+(6*9)+(5*2)+(4*4)+(3*4)+(2*1)+(1*6)=207
207 % 10 = 7
So 959244-16-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClNO3/c7-4-1-3(6(10)11)2-5(9)8-4/h1-2H,(H,8,9)(H,10,11)
