959558-28-2 Usage
Uses
Used in Organic Synthesis:
2,7-Naphthyridin-1-aMine, 4-broMois used as a building block in organic synthesis for the creation of various biologically active molecules. Its unique structure and functional groups make it a valuable component in the development of new chemical entities.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2,7-Naphthyridin-1-aMine, 4-broMois utilized as a key intermediate in the synthesis of drugs with potential therapeutic applications. Its presence in drug molecules can contribute to desired pharmacological properties, such as anti-cancer and anti-inflammatory effects.
Used in Anti-Cancer Applications:
2,7-Naphthyridin-1-aMine, 4-broMohas been studied for its potential as an anti-cancer agent. Its incorporation into drug molecules can enhance their ability to target and inhibit the growth of cancer cells, making it a promising candidate for the development of novel cancer therapies.
Used in Anti-Inflammatory Applications:
2,7-Naphthyridin-1-aMine, 4-broMohas also been investigated for its anti-inflammatory properties. By incorporating 2,7-Naphthyridin-1-aMine, 4-broMointo pharmaceutical formulations, it may be possible to develop treatments that alleviate inflammation and associated symptoms.
Used in Material Science:
2,7-Naphthyridin-1-aMine, 4-broMohas been explored for its use in the development of novel materials. Its unique chemical properties can contribute to the creation of advanced materials with specific characteristics, such as improved stability or reactivity.
Used as a Fluorescent Probe in Biological Imaging:
In the field of biological imaging, 2,7-Naphthyridin-1-aMine, 4-broMohas been investigated as a fluorescent probe. Its ability to emit light upon excitation can be harnessed for visualizing cellular structures and processes, aiding in research and diagnostics.
Check Digit Verification of cas no
The CAS Registry Mumber 959558-28-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,9,5,5 and 8 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 959558-28:
(8*9)+(7*5)+(6*9)+(5*5)+(4*5)+(3*8)+(2*2)+(1*8)=242
242 % 10 = 2
So 959558-28-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H6BrN3/c9-7-4-12-8(10)6-3-11-2-1-5(6)7/h1-4H,(H2,10,12)
959558-28-2Relevant academic research and scientific papers
7-AZAINDOLE-2,7-NAPHTHYRIDINE DERIVATIVE FOR THE TREATMENT OF TUMOURS
-
, (2015/09/28)
The compound 4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-2,7-naphthyridin-1-ylamine and pharmaceutically usable salts and/or tautomers thereof. The use of this compound for the treatment of tumours, tumour growth, tumour metastases and/or AIDS.
