96179-45-2 Usage
General Description
Benzosalicylanilide gamma-phenylbutyrate is a chemical compound that has potential anti-inflammatory and analgesic properties. It is a derivative of salicylic acid and anilide, and it has the ability to inhibit enzymes involved in the inflammatory response. BENZOSALICYLANILIDE GAMMA-PHENYLBUTYRATE has been studied for its potential role in treating inflammatory conditions such as arthritis and other related disorders. Its mechanism of action involves the inhibition of the production of prostaglandins, which are responsible for mediating inflammation and pain. Additionally, benzosalicylanilide gamma-phenylbutyrate has shown promise in preclinical studies for its potential antioxidant and neuroprotective properties. Further research is needed to fully understand the therapeutic potential of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 96179-45-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,6,1,7 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 96179-45:
(7*9)+(6*6)+(5*1)+(4*7)+(3*9)+(2*4)+(1*5)=172
172 % 10 = 2
So 96179-45-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H13NO2.C10H12O2/c19-16-11-13-7-5-4-6-12(13)10-15(16)17(20)18-14-8-2-1-3-9-14;11-10(12)8-4-7-9-5-2-1-3-6-9/h1-11,19H,(H,18,20);1-3,5-6H,4,7-8H2,(H,11,12)
