966-62-1 Usage
Uses
Used in Textile Industry:
9-(dimethylamino)benzo[a]phenoxazin-7-ium chloride is used as a dye in the textile industry for its vibrant color properties and ability to produce different shades depending on the solvent and conditions. Its light fastness, perspiration fastness, ironing fastness, and soaping properties make it suitable for various textile applications.
Used in Analytical Chemistry:
9-(dimethylamino)benzo[a]phenoxazin-7-ium chloride can be used as a colorimetric reagent in analytical chemistry due to its color-changing properties in response to different conditions, such as the presence of strong acids or bases. This makes it useful for detecting and measuring the concentration of specific substances.
Used in Research and Development:
The unique properties of 9-(dimethylamino)benzo[a]phenoxazin-7-ium chloride make it a valuable compound for research and development in various fields, including materials science, chemistry, and biology. Its potential applications can be further explored and optimized through scientific studies and experiments.
Preparation
commonly known as Meldola ‘s Blue. Naphthalen-2-ol with excess N,N-dimethyl-4-nitrosobenzenamine hydrochloride in hot ethanol in response, then will product into Zinc?double salt .
Standard
Light Fastness
Fading
Stain
C
1
Check Digit Verification of cas no
The CAS Registry Mumber 966-62-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,6 and 6 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 966-62:
(5*9)+(4*6)+(3*6)+(2*6)+(1*2)=101
101 % 10 = 1
So 966-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H15N2O.ClH/c1-20(2)13-8-9-15-17(11-13)21-16-10-7-12-5-3-4-6-14(12)18(16)19-15;/h3-11H,1-2H3;1H/q+1;/p-1
