96911-75-0 Usage
Uses
Used in Pharmaceutical Industry:
6-(PYRIDIN-4-YL)IMIDAZO[2,1-B]THIAZOLE is used as a potential therapeutic agent for various diseases due to its antimicrobial, antiviral, and antitumor properties. Its unique structure allows for interactions with biological targets, making it a valuable candidate in the search for new drugs.
Used in Drug Discovery and Development:
6-(PYRIDIN-4-YL)IMIDAZO[2,1-B]THIAZOLE is utilized as a lead compound in drug discovery and development. Its pharmacological properties and potential applications are being studied to explore its use in the creation of new therapeutic agents.
Used in Agricultural Industry:
6-(PYRIDIN-4-YL)IMIDAZO[2,1-B]THIAZOLE has the potential to be used in agriculture as a bioactive compound with antimicrobial properties. Its application in this field could contribute to the development of new pesticides or fungicides to protect crops from diseases.
Ongoing research is being conducted to further explore the pharmacological properties and potential applications of 6-(PYRIDIN-4-YL)IMIDAZO[2,1-B]THIAZOLE, which may lead to its utilization in various fields, such as medicine and agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 96911-75-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,6,9,1 and 1 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 96911-75:
(7*9)+(6*6)+(5*9)+(4*1)+(3*1)+(2*7)+(1*5)=170
170 % 10 = 0
So 96911-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H7N3S/c1-3-11-4-2-8(1)9-7-13-5-6-14-10(13)12-9/h1-7H
