97-26-7 Usage
Uses
Used in Organic Synthesis:
[4-[(4,6-diamino-m-tolyl)imino]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride is used as a reagent in the field of organic synthesis for its unique chemical properties and complex molecular structure. Its ability to participate in various chemical reactions makes it a valuable component in creating new compounds and materials.
Used in Research and Development:
In the research and development sector, [4-[(4,6-diamino-m-tolyl)imino]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride is used as an intermediate in the synthesis of more complex molecules. Its specific properties and reactivity can be harnessed to develop novel chemical entities with potential applications in various industries.
Used in Pharmaceutical Industry:
[4-[(4,6-diamino-m-tolyl)imino]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride may be utilized as a building block in the design and synthesis of new pharmaceutical compounds. Its unique structure could potentially lead to the development of innovative drugs with improved efficacy and selectivity.
Used in Chemical Industry:
In the chemical industry, [4-[(4,6-diamino-m-tolyl)imino]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride can be employed as a catalyst or a precursor in the production of various chemicals and materials. Its specific properties may enable more efficient and environmentally friendly processes in chemical manufacturing.
Used in Material Science:
[4-[(4,6-diamino-m-tolyl)imino]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride has the potential to be used in the development of new materials with unique properties. Its incorporation into polymers or other materials could lead to advancements in areas such as electronics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 97-26-7 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 9 and 7 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 97-26:
(4*9)+(3*7)+(2*2)+(1*6)=67
67 % 10 = 7
So 97-26-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N4.ClH/c1-10-8-15(14(17)9-13(10)16)18-11-4-6-12(7-5-11)19(2)3;/h4-9H,1-3H3,(H3,16,17);1H