97096-13-4 Usage
Uses
Used in Pharmaceutical and Agrochemical Synthesis:
2-Amino-3,5-dibromobenzene-1-carbohydrazide is used as a key intermediate in the synthesis of various pharmaceutical compounds and agrochemicals. Its unique structure allows for the development of new drugs and pesticides with improved efficacy and selectivity.
Used as a Corrosion Inhibitor:
The presence of the carbohydrazide group in 2-Amino-3,5-dibromobenzene-1-carbohydrazide makes it a potential corrosion inhibitor for metals. It can be used to protect metal surfaces from corrosion, extending their lifespan and improving their performance in various industrial applications.
Used in Flame Retardant Development:
2-Amino-3,5-dibromobenzene-1-carbohydrazide has been studied for its potential as a flame retardant. Its bromine content and chemical structure contribute to its ability to slow down or prevent the spread of flames, making it a valuable component in the development of fire-resistant materials.
Used as an Organic Building Block:
2-AMINO-3,5-DIBROMOBENZENE-1-CARBOHYDRAZIDE serves as an organic building block in the development of new materials. Its unique structure and properties can be utilized to create innovative materials with enhanced performance characteristics, such as improved thermal stability, mechanical strength, or chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 97096-13-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,7,0,9 and 6 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 97096-13:
(7*9)+(6*7)+(5*0)+(4*9)+(3*6)+(2*1)+(1*3)=164
164 % 10 = 4
So 97096-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H7Br2N3O/c8-3-1-4(7(13)12-11)6(10)5(9)2-3/h1-2H,10-11H2,(H,12,13)
97096-13-4Relevant academic research and scientific papers
The synthesis of some new quinazolone derivatives of potential biological activity
El-Barbary,Abou El-Ezz,Sharaf,Nielsen
, p. 1895 - 1912 (2007/10/03)
The refluxing of 3-amino-6,8-dibromo-2-thioxo-2,3-dihydro-1H-quinazolin-4- one (5) with ethyl chloroformate and/or ethyl chloroacetate afforded compounds 6 and 7 . The reaction of 5 with ethyl bromobutyrate, chloroacetyl chloride, phenacyl chloride, and p
