973-99-9 Usage
Uses
Used in Pharmaceutical Development:
N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[4-hydroxy-1-methyl-2-(propyldithio)but-1-en-1-yl]formamide monohydrochloride serves as a key component in the development of new pharmaceuticals. Its unique structure, which includes functional groups essential for biological activity, positions it as a promising candidate for further research and potential clinical applications.
Used in Antiviral Research:
In antiviral applications, N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[4-hydroxy-1-methyl-2-(propyldithio)but-1-en-1-yl]formamide monohydrochloride is studied for its ability to inhibit viral replication and infectivity. The presence of the pyrimidine ring suggests potential interactions with nucleic acids or enzymes involved in viral processes, making it a candidate for further exploration in combating viral diseases.
Used in Anticancer Research:
N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[4-hydroxy-1-methyl-2-(propyldithio)but-1-en-1-yl]formamide monohydrochloride is also being investigated for its potential role in cancer treatment. Its structure may allow it to interfere with cellular processes that contribute to tumor growth and proliferation, offering a new avenue for cancer therapy.
Used in Medicinal Chemistry Research:
N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[4-hydroxy-1-methyl-2-(propyldithio)but-1-en-1-yl]formamide monohydrochloride is a subject of interest for researchers in medicinal chemistry. Its synthesis and characterization provide valuable insights into the design and development of new drugs with improved efficacy and selectivity.
Used in Laboratory and Industrial Settings:
The monohydrochloride salt form of N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[4-hydroxy-1-methyl-2-(propyldithio)but-1-en-1-yl]formamide monohydrochloride enhances its stability, making it more suitable for use in laboratory research and industrial applications. This improved stability facilitates its handling, storage, and incorporation into various pharmaceutical formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 973-99-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,7 and 3 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 973-99:
(5*9)+(4*7)+(3*3)+(2*9)+(1*9)=109
109 % 10 = 9
So 973-99-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H24N4O2S2.ClH/c1-4-7-22-23-14(5-6-20)11(2)19(10-21)9-13-8-17-12(3)18-15(13)16;/h8,10,20H,4-7,9H2,1-3H3,(H2,16,17,18);1H
