97552-55-1 Usage
Uses
Used in Chemical Reactions and Processes:
2-Ethoxyethyl hydrogen carbonate, magnesium salt is used as a catalyst or stabilizer for various chemical reactions and processes. Its unique properties allow it to facilitate and control the rate of reactions, leading to improved efficiency and product quality.
Used in Plastics Industry:
In the plastics industry, 2-Ethoxyethyl hydrogen carbonate, magnesium salt is used as an additive to enhance the mechanical and thermal properties of polymers. Its incorporation into plastics results in improved strength, durability, and heat resistance, making the final products more reliable and long-lasting.
Used in Biomedical Field:
2-Ethoxyethyl hydrogen carbonate, magnesium salt has been studied for its potential applications in the biomedical field. It is being explored as a component in drug delivery systems, where it can help control the release of therapeutic agents, improving their efficacy and reducing side effects.
Additionally, it is being investigated for use in tissue engineering materials, where it can contribute to the development of scaffolds and other structures that promote tissue growth and regeneration. 2-Ethoxyethyl hydrogen carbonate, magnesium salt's versatility and potential in various industries make it a valuable asset in the field of material science and biomedical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 97552-55-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,7,5,5 and 2 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 97552-55:
(7*9)+(6*7)+(5*5)+(4*5)+(3*2)+(2*5)+(1*5)=171
171 % 10 = 1
So 97552-55-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H10O4.Mg/c1-2-8-3-4-9-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+2