The given chemical formula represents a complex compound consisting of a rhodium-based cation and a perchlorate anion. The cation, (Rh2(O2CCH3)I2(CO)2(C25H22P2)2)^(1+), is a rhodium(I) complex with two rhodium atoms, each coordinated to an acetate group (O2CCH3), two iodine atoms, two carbon monoxide molecules (CO), and two diphosphine ligands (C25H22P2). The anion, ClO4^(1-), is a perchlorate ion. The overall formula, (Rh2(O2CCH3)I2(CO)2(C25H22P2)2)ClO4, indicates that the rhodium complex is associated with a perchlorate counterion, forming an ionic compound. (Rh2(O2CCH3)I2(CO)2(C25H22P2)2)(1+)*ClO4(1-)=(Rh2(O2CCH3)I2(CO)2(C25H22P2)2)ClO4 is likely to be used in catalysis or as a precursor in the synthesis of other organometallic compounds.
The CAS Registry Mumber 97895-37-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,7,8,9 and 5 respectively; the second part has 2 digits, 3 and 7 respectively. Calculate Digit Verification of CAS Registry Number 97895-37: (7*9)+(6*7)+(5*8)+(4*9)+(3*5)+(2*3)+(1*7)=209 209 % 10 = 9 So 97895-37-9 is a valid CAS Registry Number.