The given chemical formula represents a complex compound consisting of a rhodium-based cation and a perchlorate anion. The cation, (Rh2(O2CCF3)Br2(CO)2(C25H22P2)2)^(1+), is a rhodium(I) complex with two rhodium atoms, each coordinated to a bromine atom, a carbonyl group (CO), and a bulky phosphine ligand (C25H22P2). The anion, ClO4^(1-), is a perchlorate ion. The overall formula, (Rh2(O2CCF3)Br2(CO)2(C25H22P2)2)ClO4, indicates that the cation and anion are combined to form a neutral complex salt. (Rh2(O2CCF3)Br2(CO)2(C25H22P2)2)(1+)*ClO4(1-)=(Rh2(O2CCF3)Br2(CO)2(C25H22P2)2)ClO4 is likely to be used in catalysis or as a precursor in the synthesis of other organometallic compounds due to its unique structure and properties.
The CAS Registry Mumber 97895-41-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,7,8,9 and 5 respectively; the second part has 2 digits, 4 and 1 respectively. Calculate Digit Verification of CAS Registry Number 97895-41: (7*9)+(6*7)+(5*8)+(4*9)+(3*5)+(2*4)+(1*1)=205 205 % 10 = 5 So 97895-41-5 is a valid CAS Registry Number.