98134-36-2 Usage
Uses
Used in Pharmaceutical Industry:
6-Chloro-2-ethyl-pyrimidin-4-yl-amine is used as a chemical intermediate for the synthesis of various pyrimidine-based pharmaceuticals. Its unique structure allows for the development of drugs with targeted therapeutic effects.
Used in Antiviral Drug Development:
In the field of antiviral research, 6-CHLORO-2-ETHYL-PYRIMIDIN-4-YL-AMINE is utilized as a building block for creating antiviral agents. Its incorporation into drug molecules can potentially enhance their ability to combat viral infections by interfering with essential viral processes.
Used in Anticancer Drug Synthesis:
6-CHLORO-2-ETHYL-PYRIMIDIN-4-YL-AMINE is also employed in the synthesis of anticancer drugs, where it contributes to the development of compounds that can target and inhibit the growth of cancer cells, offering new avenues for cancer treatment.
Used in Drug Discovery and Development:
As a versatile compound, 6-CHLORO-2-ETHYL-PYRIMIDIN-4-YL-AMINE is instrumental in drug discovery and development processes. Its adaptability in chemical reactions makes it a valuable component in the creation of novel pharmaceuticals with diverse applications in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 98134-36-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,1,3 and 4 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 98134-36:
(7*9)+(6*8)+(5*1)+(4*3)+(3*4)+(2*3)+(1*6)=152
152 % 10 = 2
So 98134-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H8ClN3/c1-2-6-9-4(7)3-5(8)10-6/h3H,2H2,1H3,(H2,8,9,10)
