98334-84-0 Usage
Uses
Used in Pharmaceutical Industry:
3-(6-Oxo-1,4,5,6-tetrahydro-pyridazin-3-yl)-propionic acid is used as a GABARAPL1 inhibitor for its potential role in modulating autophagy and other cellular processes. Its inhibitory effects on the GABARAPL1 protein may have implications in the development of therapeutic agents for various diseases and conditions.
Used in Research Applications:
In the field of scientific research, 3-(6-Oxo-1,4,5,6-tetrahydro-pyridazin-3-yl)-propionic acid serves as a valuable tool compound for studying the function and regulation of the GABARAPL1 protein. It can be used to investigate the role of autophagy in various biological processes and diseases, contributing to a better understanding of the underlying mechanisms and potential therapeutic targets.
Check Digit Verification of cas no
The CAS Registry Mumber 98334-84-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,3,3 and 4 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 98334-84:
(7*9)+(6*8)+(5*3)+(4*3)+(3*4)+(2*8)+(1*4)=170
170 % 10 = 0
So 98334-84-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O3/c10-6-3-1-5(8-9-6)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-1
