98490-61-0 Usage
General Description
5-Chloro-1,2,3,4-tetrahydro-1,6-naphthyridine is a chemical compound with the molecular formula C8H8ClN. It is a heterocyclic compound containing a naphthyridine ring with a chlorine atom attached. 5-chloro-1,2,3,4-tetrahydro-1,6-naphthyridine has potential applications in medicinal chemistry, particularly in the development of pharmaceutical drugs. Its unique structure and functional groups make it a valuable building block for the synthesis of various bioactive compounds. Additionally, its potential biological activities, such as antimicrobial and antitumor properties, make it an attractive target for research in drug discovery and development. Further study and exploration of the properties and applications of 5-Chloro-1,2,3,4-tetrahydro-1,6-naphthyridine may lead to the discovery of new therapeutic agents for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 98490-61-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,4,9 and 0 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 98490-61:
(7*9)+(6*8)+(5*4)+(4*9)+(3*0)+(2*6)+(1*1)=180
180 % 10 = 0
So 98490-61-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9ClN2/c9-8-6-2-1-4-10-7(6)3-5-11-8/h3,5,10H,1-2,4H2