98519-65-4 Usage
Uses
Used in Pharmaceutical Industry:
4-Bromo-7-chloroquinoline is used as a chemical reagent for the synthesis of autophagy antitumor inhibitors. It plays a crucial role in the development of drugs that target the autophagy process, which is a cellular mechanism involved in the degradation and recycling of cellular components. By inhibiting autophagy, these antitumor inhibitors can potentially enhance the effectiveness of cancer treatments.
Used in Agricultural Industry:
4-Bromo-7-chloroquinoline is also used as a chemical reagent in the synthesis of antifungal agents. Fungal infections can cause significant damage to crops, leading to reduced yields and economic losses. The development of effective antifungal agents is essential for protecting crops and ensuring food security. As a key component in the synthesis of these agents, 4-Bromo-7-chloroquinoline contributes to the creation of products that help combat fungal infections in various agricultural settings.
Synthesis Reference(s)
The Journal of Organic Chemistry, 72, p. 2232, 2007 DOI: 10.1021/jo062168u
Check Digit Verification of cas no
The CAS Registry Mumber 98519-65-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,5,1 and 9 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 98519-65:
(7*9)+(6*8)+(5*5)+(4*1)+(3*9)+(2*6)+(1*5)=184
184 % 10 = 4
So 98519-65-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H5BrClN/c10-8-3-4-12-9-5-6(11)1-2-7(8)9/h1-5H
