98594-47-9 Usage
Uses
Used in Pharmaceutical Industry:
Propyl 6-aminopyridazine-3-carboxylate is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure allows it to serve as a building block in the development of new therapeutic agents, potentially contributing to the creation of novel medications with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical sector, Propyl 6-aminopyridazine-3-carboxylate is utilized as a precursor in the synthesis of agrochemicals. Its chemical properties make it a valuable component in the formulation of pesticides, herbicides, and other crop protection products, enhancing their effectiveness and selectivity in controlling pests and diseases.
Used in Material Science:
Propyl 6-aminopyridazine-3-carboxylate is employed in material science for the development of new materials with specific properties. Its unique structure can be leveraged to create materials with tailored characteristics, such as improved conductivity, stability, or responsiveness to environmental stimuli, opening up new possibilities in various applications, including sensors, catalysts, and advanced materials for energy storage or conversion.
Check Digit Verification of cas no
The CAS Registry Mumber 98594-47-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,5,9 and 4 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 98594-47:
(7*9)+(6*8)+(5*5)+(4*9)+(3*4)+(2*4)+(1*7)=199
199 % 10 = 9
So 98594-47-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O2/c1-2-5-13-8(12)6-3-4-7(9)11-10-6/h3-4H,2,5H2,1H3,(H2,9,11)
