99066-77-0 Usage
Uses
Used in Medicinal Chemistry:
2-OXO-1,2-DIHYDRO-QUINAZOLINE-4-CARBOXYLIC ACID is used as a building block in the development of new pharmaceuticals, due to its unique chemical structure and properties. Its carboxylic acid and ketone groups can be utilized for the formation of various chemical bonds and interactions with other molecules, making it a valuable component in the design of novel drug candidates.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-OXO-1,2-DIHYDRO-QUINAZOLINE-4-CARBOXYLIC ACID is used as an active pharmaceutical ingredient or as an intermediate in the synthesis of various drugs. Its potential therapeutic applications may include the treatment of various diseases and disorders, depending on its specific chemical properties and interactions with biological targets.
Used in Chemical Synthesis:
2-OXO-1,2-DIHYDRO-QUINAZOLINE-4-CARBOXYLIC ACID is used as a key intermediate in the synthesis of other organic compounds, particularly in the preparation of complex organic molecules with potential applications in various fields, such as materials science, agrochemistry, and specialty chemicals. Its versatile chemical structure allows for further functionalization and modification, enabling the development of new compounds with tailored properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 99066-77-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,0,6 and 6 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 99066-77:
(7*9)+(6*9)+(5*0)+(4*6)+(3*6)+(2*7)+(1*7)=180
180 % 10 = 0
So 99066-77-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H6N2O3/c12-8(13)7-5-3-1-2-4-6(5)10-9(14)11-7/h1-4H,(H,12,13)(H,10,11,14)
