99075-24-8 Usage
General Description
[4-(2-amino-ethyl)-phenyl]-acetic acid is a chemical compound with the molecular formula C10H13NO2. It is a derivative of acetic acid and contains a phenyl ring with an aminoethyl substituent. [4-(2-AMINO-ETHYL)-PHENYL]-ACETIC ACID is commonly used in pharmaceuticals as a precursor to the synthesis of various drugs and as a building block in organic chemistry. It has been studied for its potential therapeutic properties, including its role in the development of new drugs for various medical conditions. Additionally, it has been investigated for its potential use as a ligand in coordination chemistry and as a reagent in organic synthesis. The compound exhibits a range of chemical properties and can be used in the production of a variety of different chemicals and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 99075-24-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,0,7 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 99075-24:
(7*9)+(6*9)+(5*0)+(4*7)+(3*5)+(2*2)+(1*4)=168
168 % 10 = 8
So 99075-24-8 is a valid CAS Registry Number.
InChI:InChI=1S/C10H13NO2/c11-6-5-8-1-3-9(4-2-8)7-10(12)13/h1-4H,5-7,11H2,(H,12,13)