99076-38-7 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL 4-ACETYL-2-AMINO-5-METHYL-3-FUROATE is used as a pharmaceutical intermediate for the development of various drugs. Its potential medicinal properties make it a valuable compound in the synthesis of new medications for the treatment of different diseases.
Used in Chemical Synthesis:
ETHYL 4-ACETYL-2-AMINO-5-METHYL-3-FUROATE is used as a building block in the synthesis of more complex chemical compounds. Its unique structure allows it to be incorporated into a wide range of molecules, making it a versatile component in chemical research and development.
Used in Industrial Applications:
ETHYL 4-ACETYL-2-AMINO-5-METHYL-3-FUROATE is also used in various industrial applications due to its chemical properties. Its versatility and reactivity make it suitable for use in the production of various products, such as dyes, pigments, and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 99076-38-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,0,7 and 6 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 99076-38:
(7*9)+(6*9)+(5*0)+(4*7)+(3*6)+(2*3)+(1*8)=177
177 % 10 = 7
So 99076-38-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO4/c1-4-14-10(13)8-7(5(2)12)6(3)15-9(8)11/h4,11H2,1-3H3
99076-38-7Relevant academic research and scientific papers
Investigation of hydrazine addition to functionalized furans: synthesis of new functionalized 4,4′-bipyrazole derivatives
Bakavoli, Mehdi,Feizyzadeh, Babak,Rahimizadeh, Mohammad
, p. 8965 - 8968 (2007/10/03)
The addition of hydrazine to functionalized furans 2a-d leads to a variety of 4,4′-bipyrazoles 4a-c depending on the structure of the starting materials. In one example, compound 2c was first converted to an intermediate, furo[3,4-d]pyridazine 3c which was then transformed into 4,4′-bipyrazole 4c on reacting with hydrazine.