99096-13-6 Usage
Description
(methyl 2,3,6-trideoxy-alpha-talopyranosido)-(3,2-d)-2-cyclohexanone is a complex chemical compound derived from the sugar talose, featuring a unique cyclohexanone ring structure. Its specific molecular composition may offer potential applications in organic chemistry and pharmaceutical research, although further studies are required to explore its full potential.
Uses
Used in Organic Chemistry:
(methyl 2,3,6-trideoxy-alpha-talopyranosido)-(3,2-d)-2-cyclohexanone is used as a chemical intermediate for the synthesis of various organic compounds due to its distinct molecular structure and reactivity.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (methyl 2,3,6-trideoxy-alpha-talopyranosido)-(3,2-d)-2-cyclohexanone is used as a potential candidate for drug development, leveraging its unique properties to create novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 99096-13-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,0,9 and 6 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 99096-13:
(7*9)+(6*9)+(5*0)+(4*9)+(3*6)+(2*1)+(1*3)=176
176 % 10 = 6
So 99096-13-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H16O4/c1-6-10(13)8-4-3-7(12)5-9(8)11(14-2)15-6/h3-4,6,8-11,13H,5H2,1-2H3/t6-,8-,9+,10+,11+/m1/s1