99422-01-2 Usage
Uses
Used in Agricultural Industry:
(2-PROPIONYL-5-((2-ETHYLTHIO)PROPYL)-CYCLOHEXANE-1,3-DIONE is used as a pre-emergence herbicide for controlling annual grasses and broadleaf weeds in various crops. It is particularly effective in managing weed growth in corn, cotton, and soybean fields, ensuring healthier crop development and higher yields.
(2-PROPIONYL-5-((2-ETHYLTHIO)PROPYL)-CYCLOHEXANE-1,3-DIONE is used as a selective herbicide for its ability to target and inhibit the growth of specific weeds without causing significant harm to the desired crops. This selective action is crucial for maintaining crop health and productivity while minimizing the impact on the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 99422-01-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,4,2 and 2 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 99422-01:
(7*9)+(6*9)+(5*4)+(4*2)+(3*2)+(2*0)+(1*1)=152
152 % 10 = 2
So 99422-01-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H22O3S/c1-4-11(15)14-12(16)7-10(8-13(14)17)6-9(3)18-5-2/h9-10,14H,4-8H2,1-3H3
