99433-89-3 Usage
Uses
Used in Organic Synthesis:
4-Cyclohexylphenylglyoxal hydrate is used as a reagent in organic synthesis for introducing the cyclohexylphenylglyoxal group into different organic molecules. Its ability to form stable adducts with various functional groups makes it a valuable component in creating complex organic structures.
Used in Pharmaceutical Preparation:
In the pharmaceutical industry, 4-Cyclohexylphenylglyoxal hydrate is utilized in the preparation of various pharmaceuticals and fine chemicals. Its unique chemical properties allow it to be incorporated into the synthesis of drug molecules, potentially leading to the development of new therapeutic agents.
Used in Chemical Reactions:
4-Cyclohexylphenylglyoxal hydrate is employed as a reagent in a wide range of chemical reactions, including condensation, cyclization, and oxidation processes. Its high reactivity enables the formation of diverse chemical products, contributing to the advancement of organic chemistry research and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 99433-89-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,4,3 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 99433-89:
(7*9)+(6*9)+(5*4)+(4*3)+(3*3)+(2*8)+(1*9)=183
183 % 10 = 3
So 99433-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H16O2.H2O/c15-10-14(16)13-8-6-12(7-9-13)11-4-2-1-3-5-11;/h6-11H,1-5H2;1H2
