99465-06-2 Usage
Uses
Used in Pharmaceutical Industry:
6-BROMO-2-HYDROXY-QUINOLINE-3-CARBOXYLIC ACID is used as an intermediate in the synthesis of various pharmaceuticals for its ability to be incorporated into complex molecular structures, contributing to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 6-BROMO-2-HYDROXY-QUINOLINE-3-CARBOXYLIC ACID is utilized as an intermediate in the production of agrochemicals, such as pesticides and herbicides, due to its potential to enhance the effectiveness and selectivity of these compounds in controlling pests and weeds.
Used in Antibacterial and Antimicrobial Applications:
6-BROMO-2-HYDROXY-QUINOLINE-3-CARBOXYLIC ACID is studied for its potential antibacterial and antimicrobial properties, making it a candidate for the development of new antimicrobial agents to combat resistant bacteria and other pathogens.
Used in Organic Material Development:
6-BROMO-2-HYDROXY-QUINOLINE-3-CARBOXYLIC ACID is investigated as a potential building block for the development of novel organic materials, such as organic semiconductors and optoelectronic devices, due to its unique structure and functional groups that can be tailored for specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 99465-06-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,4,6 and 5 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 99465-06:
(7*9)+(6*9)+(5*4)+(4*6)+(3*5)+(2*0)+(1*6)=182
182 % 10 = 2
So 99465-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H6BrNO3/c11-6-1-2-8-5(3-6)4-7(10(14)15)9(13)12-8/h1-4H,(H,12,13)(H,14,15)
99465-06-2Relevant academic research and scientific papers
GLYCINE B ANTAGONISTS
-
Page/Page column 48, (2010/04/27)
The invention relates to quinoline derivatives as well as their pharmaceutically acceptable salts. The invention further relates to a process for the preparation of such compounds. The compounds of the invention are glycine B antagonists and are therefore useful for the control and prevention of various disorders, including neurological disorders.
Quinolone inotropic agents
-
, (2008/06/13)
A heterocyclic-substituted 2-quinolone compound of the formula: STR1 or a pharmaceutically-acceptable salt thereof, wherein "Het" is an optionally substituted 5-or 6-membered monocyclid aromatic heterocyclic group attached by a carbon atom to the 5-, 6-, 7- or 8- position of the quinolone nucleus; R, which is attached to the 5-, 6-, 7- or 8- position, is hydrogen, C1 -C4 alkyl, C1 -C4 alkoxy, C1 -C4 alkylthio, C1 -C4 alkylsulphinyl, C1 -C4 alkylsulphonyl, halo, CF3, hydroxy, hydroxymethyl, or cyano; R1 is hydrogen, cyano (C1 -C4 alkoxy)carbonyl, C1 -C4 alkyl, nitro, halo, --NR3 R4 or --CONR3 R4 where each of R3 and R4 is hydrogen or C1 -C4 alkyl or R3 and R4 together with the nitrogen atom to which they are attached form a saturated 5- or 6-membered heterocyclic group optionally containing a further heteroatom or group selected from O, S and N--R5 where R5 is hydrogen or C 1 -C4 alkyl; R2 is hydrogen, C1 -C4 alkyl, or 2-hydroxyethyl; Y is hydrogen or C1 -C4 alkyl; and the dotted line between the 3- and 4- positions represents an optional bond. The compounds are inotropic agents useful as cardiac stimulants in the treatment of congestive heart failure.
