99573-81-6 Usage
Chemical structure
A complex structure with an allyloxy group, an octadeca-8,11-dienyloxy group, and a propan-2-ol backbone.
Allyloxy group
A functional group containing a carbon-carbon double bond and an oxygen atom, which may contribute to the compound's reactivity in organic synthesis.
Octadeca-8,11-dienyloxy group
A long-chain hydrocarbon group with two carbon-carbon double bonds, which may influence the compound's physical properties and potential applications.
Propan-2-ol backbone
A three-carbon alcohol backbone, which may confer typical alcohol properties such as solubility in water and other organic solvents.
Potential applications
Due to the presence of the allyloxy and octadeca-8,11-dienyloxy groups, this compound may have potential uses in organic synthesis and chemical reactions.
Solubility
Likely soluble in water and other organic solvents due to the propan-2-ol backbone.
Further research
Additional experimentation and research would be needed to determine the specific uses, properties, and potential applications of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 99573-81-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,5,7 and 3 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 99573-81:
(7*9)+(6*9)+(5*5)+(4*7)+(3*3)+(2*8)+(1*1)=196
196 % 10 = 6
So 99573-81-6 is a valid CAS Registry Number.
InChI:InChI=1/C24H44O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-27-23-24(25)22-26-20-4-2/h4,9-10,12-13,24-25H,2-3,5-8,11,14-23H2,1H3/b10-9-,13-12-