99724-17-1 Usage
Uses
Used in Pharmaceutical Industry:
Dimethyl-pyrrolidin-3-ylmethyl-amine is utilized as a building block in the synthesis of drugs. Its unique structure allows it to be incorporated into the molecular frameworks of various pharmaceuticals, contributing to the development of new medications.
Used in Agrochemical Industry:
In the agrochemical sector, Dimethyl-pyrrolidin-3-ylmethyl-amine serves as a key component in the synthesis of agrochemicals. It plays a role in the creation of substances that help protect crops and enhance agricultural productivity.
Used in Specialty Chemicals Synthesis:
Dimethyl-pyrrolidin-3-ylmethyl-amine is also used as a reactant in the production of specialty chemicals, which are tailored for specific applications and often have unique properties that differentiate them from commodity chemicals.
Used as a Catalyst or Reagent in Organic Reactions:
Beyond its role as a building block, dimethyl-pyrrolidin-3-ylmethyl-amine is employed as a catalyst or reagent in various organic reactions. Its ability to facilitate or enhance the rates of these reactions underscores its importance in the field of organic chemistry and chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 99724-17-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,7,2 and 4 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 99724-17:
(7*9)+(6*9)+(5*7)+(4*2)+(3*4)+(2*1)+(1*7)=181
181 % 10 = 1
So 99724-17-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H16N2/c1-9(2)6-7-3-4-8-5-7/h7-8H,3-6H2,1-2H3
99724-17-1Relevant academic research and scientific papers
3-(4,5-substituted pyrimidinamine) phenyl derivatives and application thereof
-
Paragraph 0168-0170, (2017/08/15)
The invention discloses 3-(4,5-substituted pyrimidinamine) phenyl derivatives and application thereof. The 3-(4,5-substituted pyrimidinamine) phenyl derivatives are compounds having a structure as shown in a formula (I) or pharmacologically acceptable sal
