99803-85-7 Usage
Uses
Used in Pharmaceutical Synthesis:
6-Chloro-5-fluorobenzotriazole is used as a key building block for the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties, contributing to the advancement of medicine.
Used in Agrochemical Synthesis:
In the agrochemical industry, 6-Chloro-5-fluorobenzotriazole is utilized as a precursor in the creation of compounds that can be used in crop protection and pest management, enhancing agricultural productivity and sustainability.
Used as an Enzyme Inhibitor:
6-Chloro-5-fluorobenzotriazole is studied for its potential as an enzyme inhibitor, which can be crucial in the development of treatments for various diseases where enzyme regulation is a key factor.
Used in Organic Synthesis Research:
As a valuable reagent in organic synthesis, 6-Chloro-5-fluorobenzotriazole is used to introduce the benzotriazole moiety into a range of compounds for research purposes, facilitating the exploration of new chemical reactions and the discovery of novel compounds with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 99803-85-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,8,0 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 99803-85:
(7*9)+(6*9)+(5*8)+(4*0)+(3*3)+(2*8)+(1*5)=187
187 % 10 = 7
So 99803-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H3ClFN3/c7-3-1-5-6(2-4(3)8)10-11-9-5/h1-2H,(H,9,10,11)
