99984-73-3 Usage
Uses
Used in Pharmaceutical Synthesis:
4-Amino-2-methylquinoline-6-carboxylic acid is used as a key intermediate in the synthesis of pharmaceuticals for its ability to be incorporated into complex molecular structures, contributing to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Development:
In the agrochemical industry, 4-Amino-2-methylquinoline-6-carboxylic acid is used as a building block for the creation of compounds with pesticidal properties, aiming to enhance crop protection and yield.
Used in Fine Chemicals Production:
4-Amino-2-methylquinoline-6-carboxylic acid is utilized as a component in the production of fine chemicals, where its unique structure allows for the creation of specialty chemicals used in various industries.
Used in Medicinal Chemistry Research:
As a reagent in medicinal chemistry, 4-Amino-2-methylquinoline-6-carboxylic acid is used for the development of potential drug candidates, particularly for the treatment of various diseases, due to its ability to interact with biological targets.
Used in Biochemical Research:
In biochemical research, 4-Amino-2-methylquinoline-6-carboxylic acid serves as a substrate for enzymatic reactions, aiding in the study of enzyme mechanisms and the development of enzyme inhibitors or activators.
Check Digit Verification of cas no
The CAS Registry Mumber 99984-73-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,9,8 and 4 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 99984-73:
(7*9)+(6*9)+(5*9)+(4*8)+(3*4)+(2*7)+(1*3)=223
223 % 10 = 3
So 99984-73-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2/c1-6-4-9(12)8-5-7(11(14)15)2-3-10(8)13-6/h2-5H,1H3,(H2,12,13)(H,14,15)
