99984-73-3 Usage
General Description
4-Amino-2-methylquinoline-6-carboxylic acid is a chemical compound that belongs to the quinoline carboxylic acid family. It is a derivative of quinoline, which is a heterocyclic aromatic compound. The compound contains an amino group, a methyl group and a carboxylic acid group attached to different positions on the quinoline ring. It is often used as a building block in the synthesis of pharmaceuticals, agrochemicals and other fine chemicals. 4-Amino-2-methylquinoline-6-carboxylic acid has various applications in medicinal chemistry, particularly in the development of potential drug candidates for the treatment of various diseases. Additionally, it is also used in biochemical research as a reagent or substrate for various enzymatic reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 99984-73-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,9,8 and 4 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 99984-73:
(7*9)+(6*9)+(5*9)+(4*8)+(3*4)+(2*7)+(1*3)=223
223 % 10 = 3
So 99984-73-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2/c1-6-4-9(12)8-5-7(11(14)15)2-3-10(8)13-6/h2-5H,1H3,(H2,12,13)(H,14,15)