USD $10.00-90.00 / Kilogram
USD $1.00-10.00 / Kilogram
acetonylacetone basic information |
product name: | acetonylacetone |
synonyms: | 2,5-diketohexane;2,5-hexadione;acetone, acetonyl-;acetonyl acetone 2,5-hexanedione;acetonyl-aceton;alpha,beta-diacetylethane;diacetonyl;hexane-2,5- |
cas: | 110-13-4 |
mf: | c6h10o2 |
mw: | 114.14 |
einecs: | 203-738-3 |
product categories: | pharmaceutical intermediates;ketone;aliphatics;metabolites & impurities;mutagenesis research chemicals;building blocks;c3 to c6;carbonyl compounds;chemical synthesis;ketones;organic building blocks |
mol file: | 110-13-4.mol |
acetonylacetone chemical properties |
mp | −6-−5 °c(lit.) |
bp | 191 °c(lit.) |
density | 0.973 g/ml at 25 °c(lit.) |
vapor pressure | 0.43 mm hg ( 20 °c) |
refractive index |
n |
fp | 174 °f |
water solubility | miscible |
merck | 14,71 |
brn | 506525 |
stability: | stable. incompatible with strong bases, strong reducing agents, strong oxidizing agents. flammable. |
cas database reference | 110-13-4(cas database reference) |
nist chemistry reference | ch3coch2ch2coch3(110-13-4) |
epa substance registry system | 2,5-hexanedione(110-13-4) |
safety information |
hazard codes | xn,xi |
risk statements | 36/38-48/20/21/22-36/37/38 |
safety statements | 23-26-36/37-37/39 |
wgk germany | 2 |
rtecs | mo3150000 |
f | 8 |
hs code | 29141990 |