- CAS Number
- Product Names
- Molecular Formula
| 3170-61-4 | ethyldioxidanyl | C2H5O2 |
| 87365-05-7 | ethyl 2-(isoquinolin-1-ylmethyl)-3-oxo-3-phenylpropanoate | C21H19NO3 |
| 115966-06-8 | Equinatoxin III |
| 156639-36-0 | Ethanone, 1-(2-(2-hydroxy-3-((1-methylethyl)amino)propoxy)-5-(propoxymethyl)phenyl)-, (2E)-2-butenedioate (2:1) (salt) |
| 430-41-1 | ethyl-difluoro-borane | C2H5BF2 |
| 103469-37-0 | Estiseal lc |
| 627-84-9 | ethane-1,2-diyl ditetradecanoate | C30H58O4 |
| 57941-70-5 | Ethyl (cyclohexyloxy)acetate | C10H18O3 |
| 102818-81-5 | Ethanone,1-[(1S,4aS,5R,8aS)-1,2,3,4,4a,5,6,8aoctahydro- 5-hydroxy-7-methyl-4-methylene- 1-naphthalenyl]- |
| 206756-04-9 | ecliptasaponin D | C36H58O9 |
| 24195-02-6 | ETHYL 2-CARBOXYPYRIDINE-3-CARBOXYLATE | C8H7NO4 |
| 9030-24-4 | E.C. 2.4.2.9 |
| 106327-92-8 | ETH 2112 | C61H100O9 |
| 5466-32-0 | ethyl 2-(1-piperidyl)quinoline-4-carboxylate | C17H20N2O2 |
| 9080-33-5 | E.C. 6.2.1.5 |
| 39302-98-2 | E 36 (Russian steel) |
| 64597-16-6 | Everninomicin D7 |
| 212201-05-3 | Eminensin A |
| 22719-15-9 | Ethylenediamine tartrate | C6H14N2O6 |
| 77234-66-3 | Ethanone, 2-chloro-1-[4-(1-methylpropyl)phenyl]- (9CI) | C12H15ClO |
| 4100-14-5 | ethyl 1,2,3-thiadiazole-5-carboxylate | C5H6N2O2S |
| 83783-72-6 | ethyl 4-carbamoyl-4-(phenylamino)piperidine-1-carboxylate | C15H21N3O3 |
| 78904-55-9 | Ethyl alpha-cyano-2,2,3-trimethylcyclopent-3-enebutyrate | C15H23NO2 |
| 52942-31-1 | Etoperidone | C19H28ClN5O |
| 9028-37-9 | E.C. 1.1.1.29 |
| 92503-18-9 | ethyl alpha-glutaminate | C7H14N2O3 |
| 23929-42-2 | Ergost-5-en-3-ol, (3beta,24xi)- |
| 94022-00-1 | ethyl 3-(2-hydroxy-2-methylpropyl)-3-methyloxirane-2-carboxylate | C10H18O4 |
| 120672-45-9 | ethyl (2-{4-[(2-hydroxycyclohexyl)methyl]phenoxy}ethyl)carbamate | C18H27NO4 |
| 37522-27-3 | ethyl (2Z)-chloro[2-(3-nitrophenyl)hydrazinylidene]ethanoate | C10H10ClN3O4 |
| 175204-17-8 | ETHYL 4-ACETAMIDO-3-NITROBENZOATE | C11H12N2O5 |
| 5255-65-2 | ethyl (4-ethoxyphenyl)carbamate | C11H15NO3 |
| 16732-57-3 | Ethyl 5-nitroindole-2-carboxylate | C11H10N2O4 |
| 106168-50-7 | Ethanaminium, N-4-4-(dimethylamino)phenylphenylmethylene-2,5-cyclohexadien-1-ylidene-N-ethyl-, acetate | C27H32N2O2 |
| 133992-58-2 | ETHYL 1-BENZYL-5-METHYL-1H-1,2,3-TRIAZOLE-4-CARBOXYLATE | C13H15N3O2 |
| 22813-49-6 | ethyl 2-hydroxy-3-(2-nitroimidazol-1-yl)propanoate | C8H11N3O5 |
| 82831-19-4 | ETHYL 5-METHYL-2-OXO-1H,3H-IMIDAZOLIN-4-CARBOXYLATE | C7H10N2O3 |
| 3209-72-1 | Ethyl 5-methylisoxazole-3-carboxylate | C7H9NO3 |
| 116573-18-3 | ethyl 3-[4-(6-chlorobenzooxazol-2-yl)oxyphenoxy]propanoate | C18H16ClNO5 |
| 14745-54-1 | ethenyl 3-aziridin-1-ylpropanoate | C7H11NO2 |
| 67817-95-2 | ethyl 3-amino-2-(3,6-dioxo-3,6-dihydropyridazin-1(2H)-yl)but-2-enoate | C10H13N3O4 |
| 15140-27-9 | estra-1,3,5(10)-triene-3,17beta-diol 17-cyclohexanecarboxylate | C25H34O3 |
| 21204-32-0 | epsilon-isorhodomycinone | C22H20O10 |
| 37256-90-9 | E.C. 2.1.1.16 |
| 37250-86-5 | E.C. 1.1.99.12 |
| 4447-54-5 | ethyl 2-nitrohexanoate | C8H15NO4 |
| 75410-53-6 | Echinoside A | C54H88NaO26S |
| 93923-90-1 | erythro-5-Hydroxy-L-lysine monohydrochloride | C6H15ClN2O3 |
| 75159-44-3 | ethyl 3-oxo-2-[(4-oxoquinazolin-3-yl)methyl]butanoate dihydrochloride | C15H18Cl2N2O4 |
| 69125-07-1 | ethyldimethyl[3-[(1-oxododecyl)amino]propyl]ammonium ethyl sulphate | C21H46N2O5S |
| 83763-26-2 | Ethyl N-formyl-3-oxo-N-(1-phenylethyl)-alaninate | C14H17NO4 |
| 183136-03-0 | Ethylcarbamic acid 2-(3-oxo-1,2-benzisothiazol-2(3H)-yl)ethyl ester |
| 144193-98-6 | ethyl 3,4,4-trifluoro-2,2-dimethylbut-3-enoate | C8H11F3O2 |
| 76352-18-6 | exo-4-Amino-5-chloro-2-methoxy-N-(8-(2-thenyl)-8-azabicyclo(3.2.1)oct- 3-yl)benzamide | C20H24ClN3O2S |
| 97050-94-7 | Ethanaminium, 2-((3-((dimethylamino)carbonyloxy)phenoxy)acetylamino)-N,N,N-triethyl-, iodide |
| 22883-85-8 | ethyl 6-quinolyl ether | C11H11NO |
| 89909-42-2 | ethyl 4-bromo-3-methyl-1H-pyrrole-2-carboxylate | C8H10 Br N O2 |
| 6287-87-2 | ethyl (phenylcarbonyl)dithiocarbamate | C10H11 N O S2 |
| 144832-55-3 | Ethanedioic acid,compounds,mixt. with aminomethyl[[4-[(sulfophenyl)amino]phenyl][4- [(sulfophenyl)imino]-2,5-cyclohexadien-1- ylidene]methyl]benzenesulfonic acid disodium salt and 7-hydroxy-8-(phenylazo)-1,3- naphthalenedisulfonic acid disodium salt |
| 37246-13-2 | EP 79 (alloy) |
| 18318-53-1 | Ethanone,1-[(3R,3aR,5R,7aS)-octahydro-3-hydroxy-7a-methyl-5-(1-methylethenyl)-3aH-inden-3a-yl]- | C15H24 O2 |
| 69037-47-4 | ethyl 2-{[1-(2-phenylethyl)piperidin-4-yl](propanoyl)amino}benzoate hydrochloride | C25H32 N2 O3 . Cl H |
| 5678-37-5 | ethyl (2Z)-2-({2-[(4-chlorobenzyl)oxy]phenyl}methylidene)-7-methyl-5-(4-methylphenyl)-3-oxo-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate | C4H16 N2 O Si2 |
| 100684-01-3 | Extracts (petroleum),clay-treated gas oil solvent |
| 101492-44-8 | ethyl 2-(4-chlorophenyl)prop-2-enoate | C11H11 Cl O2 |
| 39877-24-2 | eledoisin perfluoroacetate | C56H86F3N13O17S |
| 71486-82-3 | Ethanol,2,2'-iminobis-, N-[3-(C12-15-alkyloxy)propyl] derivs., N-oxides |
| 26234-95-7 | Ethanol,2,2'-[(6-methyl-1,3,5-triazine-2,4-diyl)bis(methylimino)]bis- (9CI) | C10H19 N5 O2 |
| 7468-18-0 | ethyl 2,2-bis[(methylamino)methyl]-3-oxo-4-phenylbutanoate | C16H24 N2 O3 . 2 Cl H |
| 27091-68-5 | ethyl [(2,6-dimethyl-4-oxo-4H-pyran-3-yl)carbonyl]carbamate | C11H13 N O5 |
| 54805-47-9 | ethyl 2-[benzoyl(4-ethoxy-4-oxobutyl)amino]-4-phenylthiophene-3-carboxylate | C26H27 N O5 S |
| 26988-03-4 | Emetan-2'-ethanol, a-(ethoxymethyl)-6',7',10,11-tetramethoxy-,dihydrochloride (9CI) | C34H50 N2 O6 . 2 Cl H |
| 94158-08-4 | ethyl 1-benzyl-5-hydroxy-1H-1,2,3-triazole-4-carboxylate | C12H13 N3 O3 |
| 51807-11-5 | ethylenebis(methylphosphinic) acid | C4H12 O4 P2 |
| 121053-28-9 | Electrolytes, cobalt-manufg. |
| 72845-42-2 | Ethanol, 2-amino-, compd. with α-(2-cyanoethyl)-ω -(nonylsulfophenoxy)poly(oxy-1,2-ethanediyl) (1:1) | C2H7NO.(C2H4O)nC18H27NO4S |
| 147015-57-4 | EnvD protein |
| 70561-79-4 | Exozoline | C23H27 N O |
| 83652-68-0 | Enhydrotoxin b (9CI) |
| 69123-49-5 | ethyl 4-[(1,3,4-thiadiazol-2-ylcarbamoyl)amino]benzoate | C12H12 N4 O3 S |
| 4771-17-9 | ethyl 3,7-dinitro-1H-indole-2-carboxylate | C11H9 N3 O6 |
| 20267-20-3 | ethylene dipivalate | C12H22 O4 |
| 57058-35-2 | Ethanimidamide,N'-(diphenylmethyl)-N,N-dimethyl- | C17H20 N2 |
| 51965-90-3 | ethyl 1-methyl-2-oxocyclopent-3-ene-1-carboxylate | C9H12 O3 |
| 5602-52-8 | ethyl 4-(3-iodophenyl)-2,7,7-trimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate | C23H34 Cl6 O2 |
| 92332-30-4 | Eugenia glaucescens,ext. |
| 5128-54-1 | Ethanone,1-(2,4-dihydroxy-5-methoxyphenyl)-2-(4-methoxyphenyl)- | C16H16 O5 |
| 6368-09-8 | ethyl 2-({[2-(2-chlorophenyl)quinolin-4-yl]carbonyl}amino)-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate | C37H72 N O11 P |
| 6316-15-0 | ethyl tert-butyl(nitroso)carbamate | C7H14 N2 O3 |
| 5183-62-0 | ethyl 1,3-dimethyl-2-oxocyclohexanecarboxylate | C11H18 O3 |
| 34446-66-7 | ethyl 4-{4-[(1E)-3-(butan-2-yl)-3-methyltriaz-1-en-1-yl]phenyl}butanoate | C17H27 N3 O2 |
| 55508-85-5 | ethyl 2-[1-(4-methylphenyl)ethylidene]hydrazinecarboxylate | C12H16 N2 O2 |
| 58339-45-0 | enocin |
| 166547-20-2 | eurycarpin A | C20H18 O5 |
| 3190-75-8 | Ethanethiol,2,2',2''-phosphinidynetris- (9CI) | C6H15 P S3 |
| 134937-61-4 | Ethanone,2-(2,5-dimethylphenoxy)-1-(1-pyrrolidinyl)- | C14H19 N O2 |
| 90367-08-1 | Ethanol, piperazinederivs. |
| 78816-48-5 | ethyl [5-(N,N-diethyl-beta-alanyl)-10,11-dihydro-5H-dibenzo[b,f]azepin-3-yl]carbamate hydrochloride | C24H31 N3 O3 . Cl H |
| 20417-61-2 | ETHYL 2-FORMYL-1-CYCLOPROPANECARBOXYLATE | C7H10O3 |
| 97051-52-0 | Ethanaminium,2-[[2-[4-[[(dimethylamino)carbonyl]oxy]phenoxy]acetyl]amino]-N-ethyl-N,N-dimethyl-,iodide (1:1) | C17H28 N3 O4 . I |
- About us - Payment - Contact us - Links - Help Center - Disclaimer
- SiteMap | Product SiteMap | New CAS | Cas Database | Article Data | Product Name | Chemical Catalog | Manufacturers | VIP Product | Suppliers
- ©2008 LookChem.com,License:ICP NO.lookchem:Zhejiang16009103 complaints:service@lookchem.com
- [Hangzhou]86-0571-87562588,87562578,87562573 Our Legal adviser: Lawyer