- CAS Number
- Product Names
- Molecular Formula
| 20041-39-8 | Eugenolol | C16H25NO3 |
| 128442-18-2 | epoxytocopherone | C29H50 O5 |
| 149992-31-4 | Ergoline-8-carboxamide,N-[(1R,2S)-2-hydroxycyclopentyl]-6-methyl-, (8b)- (9CI) | C21H27 N3 O2 |
| 122390-49-2 | endozepine, des-(Gly-Ile)- | C439H682 N112 O135 S3 |
| 5751-80-4 | Ethyl thiophene-3-carboxylate | C7H8 O2 S |
| 14102-42-2 | ethyl 4-[(N-cyclohexylglycyl)amino]-2-hydroxybenzoate hydrochloride (1:1) | C17H24 N2 O4 . Cl H |
| 24664-52-6 | Ethyl=4-[[(3-methyl-5-oxo-1-phenyl-2-pyrazolin-4-ylidene)methyl]amino]benzoate | C20H19 N3 O3 |
| 209850-88-4 | Ecdysteroside | C39H64O17 |
| 26489-06-5 | ethyl [2-methyl-2-(naphthalen-1-yl)-4-(piperidin-1-yl)butyl]carbamate | C23H32 N2 O2 |
| 169869-90-3 | Exatecan mesilate | C25H26FN3O7S |
| 3551-50-6 | Ethanethioic acid, S-[(1R,2R)-2-hydroxycyclopentyl] ester, rel- (9CI) | C7H12 O2 S |
| 67633-63-0 | ethyldimethyl[3-[(1-oxoisooctadecyl)amino]propyl]ammonium ethyl sulphate | C6H8 O7 . Nd |
| 29169-19-5 | ethyl [(methylsulfonyl)oxy]acetate | C5H10 O5 S |
| 64875-51-0 | ethyl N-[3-(4-ethoxyphenyl)-3-oxopropyl]glycinate hydrochloride | C15H21 N O4 . Cl H |
| 7063-80-1 | ethyl 1-[5-cyano-3-[(3-cyclohexyl-4-oxo-2-sulfanylidene-thiazolidin-5- ylidene)methyl]-1-ethyl-4-methyl-6-oxo-pyridin-2-yl]piperidine-4-carbo xylate | C9H17 N O |
| 161811-53-6 | Ethane,1,1,1-trifluoro-,mixt. with chlorodifluoromethane |
| 69344-84-9 | Ethanol, 2,2-iminodi-, mixed with quercitin 3-rutinoside |
| 1112-00-1 | ethynyl(trimethyl)stannane | C5H10 Sn |
| 9037-46-1 | Exodeoxyribonuclease I |
| 40031-31-0 | ERYTHRULOSE | C4H8O4 |
| 127120-70-1 | Ethenol,polymers,polymer with ethene,octadecylcarbamate |
| 64439-43-6 | eupaformosanin | C22H28 O8 |
| 161075-12-3 | Ethene, tetrafluoro-, oxidized, polymd., reduced, Me esters |
| 64050-15-3 | ETHOXYPROPYLACRYLATE | C8H14 O3 |
| 91399-18-7 | Ergosta-3,5,24-trien-26-oic acid,14,20-epoxy-17,22,27-trihydroxy-1-oxo- ,ä-lactone,(17R,20R,22R)- |
| 145865-73-2 | ethyl 3-{[(2E)-2-(4-methoxybenzylidene)hydrazinyl]sulfonyl}-1-methyl-1H-pyrazole-4-carboxylate | C15H18 N4 O5 S |
| 22286-90-4 | ethyl 3-(butylamino)-2-phenylpropanoate | C15H23 N O2 |
| 16992-94-2 | ethyl oxo(1-oxo-1,2,3,4-tetrahydrophenanthren-2-yl)acetate | C18H16 O4 |
| 64262-38-0 | ethyl cyano(3-methylphenyl)acetate | C12H13 N O2 |
| 29322-89-2 | ethenol - 1-ethenyl-1H-imidazole (1:1) | C7H10N2O |
| 604-58-0 | equilenin benzoate | C25H22O3 |
| 9031-20-3 | E.C. 4.5.1.1 |
| 995-37-9 | ethyl (2E)-3-(diethoxyphosphoryl)prop-2-enoate | C9H17O5P |
| 9001-48-3 | EC 1.6.4.2 | NULL |
| 50454-44-9 | ethanedioate, neptunium-~237~Np salt (1:1) | C2NpO4-2 |
| 63363-73-5 | E.C. 2.4.1.153 |
| 67749-14-8 | ethyl 6-diazo-5,6-dihydro-5-oxonaphthalene-1-sulphonate | C12H10N2O4S |
| 26088-68-6 | ethyl 2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate | C15H17 N O2 |
| 153366-11-1 | Ethanol,2-[[2-[(2-amino-9H-purin-6-yl)oxy]ethyl]thio]- | C9H13 N5 O2 S |
| 37256-36-3 | E.C. 1.6.99.5 |
| 155740-04-8 | Euonymoside A | C35H54 O14 |
| 12679-78-6 | Etacidine (9CI) |
| 58337-38-5 | erythro-9-(2-Hydroxy-3-nonyl)adenine hydrochloride, erythro-9-Amino-β-hexyl-α-methyl-9H-purine-9-ethanol hydrochloride | C14H23 N5 O . Cl H |
| 52605-49-9 | Ethyl sarcosinate hydrochloride | C5H11NO2.HCl |
| 25084-90-6 | Ethylene, polymer with tert-butyl acrylate | (C7H12O2.C2H4)x |
| 72814-29-0 | ethyl 3-(3-cyclohexyl-3-hydroxypropyl)-2,5-dioxoimidazolidine-4-heptanoate | C21H36 N2 O5 |
| 28649-59-4 | Euphorbiasteroid | C32H40 O8 |
| 37312-06-4 | EI 274L |
| 102395-71-1 | ethyl 1-[(4-methylphenyl)carbamoyl]-4-phenyl-piperidine-4-carboxylate | C22H26 N2 O3 |
| 10271-27-9 | ethyl [(1E)-3-(4-nitrophenyl)triaz-1-en-1-yl]acetate | C10H12 N4 O4 |
| 144194-06-9 | ethyl (3Z)-4-chloro-3,4-difluoro-2,2-dimethylbut-3-enoate | C8H11 Cl F2 O2 |
| 480-00-2 | Eleutherol | C14H12O4 |
| 90028-44-7 | Eryngium maritimum, ext. |
| 2226-86-0 | ETHYL-2,4-DIMETHYL-5-PYRIMIDINE CARBOXYLATE | C9H12 N2 O2 |
| 14923-66-1 | ethyl 2-(2-carbamoylhydrazinylidene)propanoate | C6H11 N3 O3 |
| 28516-38-3 | Ethanol, 2,2-thiobis-, homopolymer |
| 21985-16-0 | ethyl cyano(1-methylpyrrolidin-2-ylidene)acetate | C10H14 N2 O2 |
| 116409-02-0 | ethyl 6-methoxy-6-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromene-7-carboxylate | C24H28 O9 |
| 104907-90-6 | ethyl 5-(2-methyl-4-oxoquinazolin-3(4H)-yl)-1-phenyl-1H-pyrazole-4-carboxylate | C21H18 N4 O3 |
| 100684-05-7 | Extracts (petroleum),light vacuum gas oil solvent, clay-treated |
| 53786-46-2 | ethyl 4-(5-chloro-2,3-dihydro-2-oxo-1H-benzimidazol-1-yl)piperidine-1-carboxylate | C15H18 Cl N3 O3 |
| 53786-42-8 | ethyl 4-(hydroxyimino)piperidine-1-carboxylate | C8H14 N2 O3 |
| 37256-68-1 | E.C. 1.14.12.2 |
| 158511-59-2 | ECLALBASAPONIN I | C42H68 O14 |
| 14656-25-8 | ethyl (2E)-2-(diethoxyphosphoryl)-3-(4-methoxyphenyl)prop-2-enoate | C16H23 O6 P |
| 7356-04-9 | ethyl 1-methyl-3-oxo-cyclohexane-1-carboxylate | C10H16 O3 |
| 5693-86-7 | ETHYLENE-1,2-DIFORMAMIDOXIME | C5H12 N4 O2 |
| 149633-57-8 | ECKLONIALACTONE F | C20H30 O4 |
| 125433-96-7 | Europium(III) cryptate | C42H42 Eu N12 O2 |
| 100752-88-3 | Ethanone, 1-(1,2,3,6-tetrahydro-1-methyl-4-pyridinyl)- (9CI) | C8H13 N O |
| 84696-12-8 | Eleutherococcus senticosus, ext. |
| 76899-35-9 | Eicosenoic acid, methyl ester, (Z)- | C21 H42 O2 |
| 149633-56-7 | ecklonialactone E | C20H28 O3 |
| 9029-82-7 | E.C. 2.1.1.11 |
| 68910-05-4 | Ethanol, 2-amino-, reaction products with ammonia, by-products from |
| 21190-16-9 | ETHYL 4-AMINO-5-IMIDAZOLECARBOXYLATE | C6H9N3O2 |
| 16234-88-1 | ethyl [3-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylidene)propyl]methylcarbamate | C22H25NO2 |
| 119184-11-1 | Ethanamine,2,2'-[2,5-thiophenediylbis(4,2-pyrimidinediylthio)]bis[N,N-dimethyl-, conjugatediacid (9CI) | C20H26 N6 S3 . 2 H |
| 51422-54-9 | ETHYLENE GLYCOL TERT-BUTYLETHYL ETHER | C8H18O2 |
| 63704-58-5 | ethyl tripropan-2-yl diphosphate | C11H26 O7 P2 |
| 147604-74-8 | EFH5 protein |
| 75854-68-1 | ethyl 4-methylnonan-1-oate | C12H24 O2 |
| 3440-79-7 | ETHYLTRIPROPYLTIN | C11H26 Sn |
| 57853-97-1 | EP 794 |
| 36310-93-7 | Eskatan GLH |
| 17692-34-1 | Etodroxizine | C23H31 Cl N2 O3 |
| 4027-57-0 | Ethyl 3-methyl-1H-pyrazole-5-carboxylate | C7H10N2O2 |
| 22048-54-0 | ethyl 1-[3-(dimethylamino)propyl]-3,3-dimethyl-1,3-dihydro-2-benzofuran-1-carboxylate hydrochloride (1:1) | C18H27 N O3 . Cl H |
| 82560-66-5 | ethyl 3-[[(2,2-dimethyl-3H-benzofuran-7-yl)oxycarbonyl-methyl-amino]su lfanyl-hexyl-amino]propanoate | C23H36 N2 O5 S |
| 100581-42-8 | ETH 500 | C72H116BCl4N |
| 9025-74-5 | E.C. 3.1.3.17 |
| 5464-72-2 | ethyl 3-hydroxy-3-methyl-nonanoate | C12H24 O3 |
| 68310-41-8 | Ethylacrylate-methacrylic acid polymer, triethanolamine salt | C6H15NO3.x(C5H8O2.C4H6O2)x |
| 10031-54-6 | EUROPIUM(III) SULFATE 99.99+% | Eu. H2 O4 S |
| 142713-49-3 | Erythrinan-3,15-diol,1,6-didehydro-, (3b)- (9CI) | C16H19 N O2 |
| 6792-21-8 | Ethene,chlorotrifluoro-,dimer |
| 149725-26-8 | Ergosta-1,4-dien-3-one,7-hydroxy-22,24,25-[[(S)-3-pyridinylmethylidyne]tris(oxy)]-, (7a,22R)- (9CI) | C34H45 N O5 |
| 30472-11-8 | ethylmagnesium(1+) tetraethylaluminate(1-) | C10H25AlMg |
| 146935-40-2 | epocarbazolin B | C23H29 N O4 |
| 87453-63-2 | endo-ethenotetrahydrooripavine | C20H24 N2 O3 |
- About us - Payment - Contact us - Links - Help Center - Disclaimer
- SiteMap | Product SiteMap | New CAS | Cas Database | Article Data | Product Name | Chemical Catalog | Manufacturers | VIP Product | Suppliers
- ©2008 LookChem.com,License:ICP NO.lookchem:Zhejiang16009103 complaints:service@lookchem.com
- [Hangzhou]86-0571-87562588,87562578,87562573 Our Legal adviser: Lawyer